C24H30N2O2 — CID 3009651
methyl (15S,19R)-15,19-dimethyl-3,10-diazapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2(11),3,9,12-pentaene-19-carboxylate (PubChem CID 3009651) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is methyl (15S,19R)-15,19-dimethyl-3,10-diazapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2(11),3,9,12-pentaene-19-carboxylate.
| Compound Name | methyl (15S,19R)-15,19-dimethyl-3,10-diazapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2(11),3,9,12-pentaene-19-carboxylate |
|---|---|
| PubChem CID | 3009651 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | methyl (15S,19R)-15,19-dimethyl-3,10-diazapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2(11),3,9,12-pentaene-19-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)c3ccc4nc5c(nc4c3CCC12)CCCC5 |
| InChI | InChI=1S/C24H30N2O2/c1-23-13-6-14-24(2,22(27)28-3)20(23)12-9-15-16(23)10-11-19-21(15)26-18-8-5-4-7-17(18)25-19/h10-11,20H,4-9,12-14H2,1-3H3/t20?,23-,24-/m1/s1 |
| InChIKey | XLWQFEOOOVSTOV-BPAKYRGESA-N |
| XLogP | 4.69 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |