C29H46N4O4 — CID 10768152
methyl (1R,4aS)-1,4a-dimethyl-7-propan-2-yl-6,8-bis(propan-2-ylcarbamoylamino)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 10768152) has the molecular formula C29H46N4O4 and a molecular weight of 514.71 g/mol. Its IUPAC name is methyl (1R,4aS)-1,4a-dimethyl-7-propan-2-yl-6,8-bis(propan-2-ylcarbamoylamino)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS)-1,4a-dimethyl-7-propan-2-yl-6,8-bis(propan-2-ylcarbamoylamino)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 10768152 |
| Molecular Formula | C29H46N4O4 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | methyl (1R,4aS)-1,4a-dimethyl-7-propan-2-yl-6,8-bis(propan-2-ylcarbamoylamino)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)c3cc(NC(=O)NC(C)C)c(C(C)C)c(NC(=O)NC(C)C)c3CCC12 |
| InChI | InChI=1S/C29H46N4O4/c1-16(2)23-21(32-26(35)30-17(3)4)15-20-19(24(23)33-27(36)31-18(5)6)11-12-22-28(20,7)13-10-14-29(22,8)25(34)37-9/h15-18,22H,10-14H2,1-9H3,(H2,30,32,35)(H2,31,33,36)/t22?,28-,29-/m1/s1 |
| InChIKey | DLFHUOKKZIVODU-GVYXLBKYSA-N |
| XLogP | 6.05 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |