C35H44N2O4 — CID 11028095
methyl (1R,4aS,10aR)-6,8-bis(4-methoxyanilino)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 11028095) has the molecular formula C35H44N2O4 and a molecular weight of 556.75 g/mol. Its IUPAC name is methyl (1R,4aS,10aR)-6,8-bis(4-methoxyanilino)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,10aR)-6,8-bis(4-methoxyanilino)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 11028095 |
| Molecular Formula | C35H44N2O4 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | methyl (1R,4aS,10aR)-6,8-bis(4-methoxyanilino)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)c3cc(Nc4ccc(OC)cc4)c(C(C)C)c(Nc4ccc(OC)cc4)c3CC[C@@H]12 |
| InChI | InChI=1S/C35H44N2O4/c1-22(2)31-29(36-23-9-13-25(39-5)14-10-23)21-28-27(32(31)37-24-11-15-26(40-6)16-12-24)17-18-30-34(28,3)19-8-20-35(30,4)33(38)41-7/h9-16,21-22,30,36-37H,8,17-20H2,1-7H3/t30-,34-,35-/m1/s1 |
| InChIKey | JJQZCMIDROMSKU-KVFIQDKASA-N |
| XLogP | 8.50 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |