C28H38N2O3 — CID 10961368
methyl (1R,4aS,10aR)-8-amino-6-(4-methoxyanilino)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 10961368) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is methyl (1R,4aS,10aR)-8-amino-6-(4-methoxyanilino)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,10aR)-8-amino-6-(4-methoxyanilino)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 10961368 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | methyl (1R,4aS,10aR)-8-amino-6-(4-methoxyanilino)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)c3cc(Nc4ccc(OC)cc4)c(C(C)C)c(N)c3CC[C@@H]12 |
| InChI | InChI=1S/C28H38N2O3/c1-17(2)24-22(30-18-8-10-19(32-5)11-9-18)16-21-20(25(24)29)12-13-23-27(21,3)14-7-15-28(23,4)26(31)33-6/h8-11,16-17,23,30H,7,12-15,29H2,1-6H3/t23-,27-,28-/m1/s1 |
| InChIKey | PAZHDTCIWVRWHZ-XTBZXYEFSA-N |
| XLogP | 6.33 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|