C27H35NO2 — CID 11825655
methyl (1R,4aS,10aR)-6-anilino-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 11825655) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is methyl (1R,4aS,10aR)-6-anilino-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,10aR)-6-anilino-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 11825655 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | methyl (1R,4aS,10aR)-6-anilino-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)c3cc(Nc4ccccc4)c(C(C)C)cc3CC[C@@H]12 |
| InChI | InChI=1S/C27H35NO2/c1-18(2)21-16-19-12-13-24-26(3,14-9-15-27(24,4)25(29)30-5)22(19)17-23(21)28-20-10-7-6-8-11-20/h6-8,10-11,16-18,24,28H,9,12-15H2,1-5H3/t24-,26-,27-/m1/s1 |
| InChIKey | OGMPBBNUQSXCFW-ZRJLEYOISA-N |
| XLogP | 6.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |