C24H38O3Si — CID 629977
methyl 1,4a-dimethyl-7-(2-trimethylsilyloxypropan-2-yl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 629977) has the molecular formula C24H38O3Si and a molecular weight of 402.65 g/mol. Its IUPAC name is methyl 1,4a-dimethyl-7-(2-trimethylsilyloxypropan-2-yl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl 1,4a-dimethyl-7-(2-trimethylsilyloxypropan-2-yl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 629977 |
| Molecular Formula | C24H38O3Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | methyl 1,4a-dimethyl-7-(2-trimethylsilyloxypropan-2-yl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)C1(C)CCCC2(C)c3ccc(C(C)(C)O[Si](C)(C)C)cc3CCC12 |
| InChI | InChI=1S/C24H38O3Si/c1-22(2,27-28(6,7)8)18-11-12-19-17(16-18)10-13-20-23(19,3)14-9-15-24(20,4)21(25)26-5/h11-12,16,20H,9-10,13-15H2,1-8H3 |
| InChIKey | JIGCRUCOUGFZQH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|