C17H28O6 — CID 11110260
dimethyl 2-[(1R,2R,3R)-3-(methoxymethoxy)-2-methyl-2-prop-2-enylcyclohexyl]propanedioate (PubChem CID 11110260) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is dimethyl 2-[(1R,2R,3R)-3-(methoxymethoxy)-2-methyl-2-prop-2-enylcyclohexyl]propanedioate.
| Compound Name | dimethyl 2-[(1R,2R,3R)-3-(methoxymethoxy)-2-methyl-2-prop-2-enylcyclohexyl]propanedioate |
|---|---|
| PubChem CID | 11110260 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | dimethyl 2-[(1R,2R,3R)-3-(methoxymethoxy)-2-methyl-2-prop-2-enylcyclohexyl]propanedioate |
| SMILES | C=CC[C@]1(C)[C@@H](C(C(=O)OC)C(=O)OC)CCC[C@H]1OCOC |
| InChI | InChI=1S/C17H28O6/c1-6-10-17(2)12(8-7-9-13(17)23-11-20-3)14(15(18)21-4)16(19)22-5/h6,12-14H,1,7-11H2,2-5H3/t12-,13-,17-/m1/s1 |
| InChIKey | OSKABENBWGVJHR-PBFPGSCMSA-N |
| XLogP | 2.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|