C13H22O4 — CID 10911709
[(1R,2S,3S,6S)-2-ethenyl-3,6-dihydroxy-2,6-dimethylcyclohexyl]methyl acetate (PubChem CID 10911709) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is [(1R,2S,3S,6S)-2-ethenyl-3,6-dihydroxy-2,6-dimethylcyclohexyl]methyl acetate.
| Compound Name | [(1R,2S,3S,6S)-2-ethenyl-3,6-dihydroxy-2,6-dimethylcyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 10911709 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | [(1R,2S,3S,6S)-2-ethenyl-3,6-dihydroxy-2,6-dimethylcyclohexyl]methyl acetate |
| SMILES | C=C[C@]1(C)[C@@H](O)CC[C@](C)(O)[C@H]1COC(C)=O |
| InChI | InChI=1S/C13H22O4/c1-5-12(3)10(8-17-9(2)14)13(4,16)7-6-11(12)15/h5,10-11,15-16H,1,6-8H2,2-4H3/t10-,11-,12-,13-/m0/s1 |
| InChIKey | SGZVMBCAFAFWNY-CYDGBPFRSA-N |
| XLogP | 1.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|