C12H21ClHgO4 — CID 134856502
[(1S,2R,3R,4S)-3-(acetyloxymethyl)-4-hydroxy-2-(hydroxymethyl)-2,4-dimethylcyclohexyl]-chloromercury (PubChem CID 134856502) has the molecular formula C12H21ClHgO4 and a molecular weight of 465.34 g/mol. Its IUPAC name is [(1S,2R,3R,4S)-3-(acetyloxymethyl)-4-hydroxy-2-(hydroxymethyl)-2,4-dimethylcyclohexyl]-chloromercury.
| Compound Name | [(1S,2R,3R,4S)-3-(acetyloxymethyl)-4-hydroxy-2-(hydroxymethyl)-2,4-dimethylcyclohexyl]-chloromercury |
|---|---|
| PubChem CID | 134856502 |
| Molecular Formula | C12H21ClHgO4 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | [(1S,2R,3R,4S)-3-(acetyloxymethyl)-4-hydroxy-2-(hydroxymethyl)-2,4-dimethylcyclohexyl]-chloromercury |
| SMILES | CC(=O)OC[C@H]1[C@](C)(CO)[C@@H]([Hg]Cl)CC[C@]1(C)O |
| InChI | InChI=1S/C12H21O4.ClH.Hg/c1-9(14)16-7-10-11(2,8-13)5-4-6-12(10,3)15;;/h5,10,13,15H,4,6-8H2,1-3H3;1H;/q;;+1/p-1/t10-,11-,12-;;/m0../s1 |
| InChIKey | XVRLLNCJEJYCQN-MGKSKXMVSA-M |
| XLogP | 1.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|