C17H29ClHgO3 — CID 100975612
CID 100975612 (PubChem CID 100975612) has the molecular formula C17H29ClHgO3 and a molecular weight of 517.46 g/mol.
| Compound Name | CID 100975612 |
|---|---|
| PubChem CID | 100975612 |
| Molecular Formula | C17H29ClHgO3 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | — |
| SMILES | CC(=O)OC[C@@H]1[C@@]2(C)CC[CH]C(C)(C)[C@@H]2CC[C@@]1(C)O.[Cl-].[Hg+] |
| InChI | InChI=1S/C17H29O3.ClH.Hg/c1-12(18)20-11-14-16(4)9-6-8-15(2,3)13(16)7-10-17(14,5)19;;/h8,13-14,19H,6-7,9-11H2,1-5H3;1H;/q;;+1/p-1/t13-,14+,16-,17+;;/m0../s1 |
| InChIKey | LZBPOYZYOFSZBX-VWLZYEGWSA-M |
| XLogP | 0.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|