C21H34O5 — CID 164671696
ethyl 2-[(1S,2S,4aR,6S,8aS)-6-acetyloxy-2-formyl-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetate (PubChem CID 164671696) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is ethyl 2-[(1S,2S,4aR,6S,8aS)-6-acetyloxy-2-formyl-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetate.
| Compound Name | ethyl 2-[(1S,2S,4aR,6S,8aS)-6-acetyloxy-2-formyl-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 164671696 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | ethyl 2-[(1S,2S,4aR,6S,8aS)-6-acetyloxy-2-formyl-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@@]2(C)CC[C@H](OC(C)=O)C(C)(C)[C@@H]2CC[C@]1(C)C=O |
| InChI | InChI=1S/C21H34O5/c1-7-25-18(24)12-16-20(5,13-22)10-8-15-19(3,4)17(26-14(2)23)9-11-21(15,16)6/h13,15-17H,7-12H2,1-6H3/t15-,16+,17-,20+,21-/m0/s1 |
| InChIKey | CHINRCFDWYLGIF-DNJKFYBTSA-N |
| XLogP | 3.93 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|