C24H38O5 — CID 162857863
[(2R,3S,4aS,6aR,8R,10aR,10bS)-2-acetyloxy-3-ethenyl-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-8-yl] acetate (PubChem CID 162857863) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is [(2R,3S,4aS,6aR,8R,10aR,10bS)-2-acetyloxy-3-ethenyl-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-8-yl] acetate.
| Compound Name | [(2R,3S,4aS,6aR,8R,10aR,10bS)-2-acetyloxy-3-ethenyl-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-8-yl] acetate |
|---|---|
| PubChem CID | 162857863 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | [(2R,3S,4aS,6aR,8R,10aR,10bS)-2-acetyloxy-3-ethenyl-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-8-yl] acetate |
| SMILES | C=C[C@]1(C)O[C@@]2(C)CC[C@H]3C(C)(C)[C@H](OC(C)=O)CC[C@@]3(C)[C@@H]2C[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H38O5/c1-9-23(7)20(28-16(3)26)14-18-22(6)12-11-19(27-15(2)25)21(4,5)17(22)10-13-24(18,8)29-23/h9,17-20H,1,10-14H2,2-8H3/t17-,18-,19+,20+,22+,23-,24-/m0/s1 |
| InChIKey | IFSVDRCNVACXNB-KQWKSFQDSA-N |
| XLogP | 4.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|