C22H36O4 — CID 14108801
(3-ethenyl-8-hydroxy-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-5-yl) acetate (PubChem CID 14108801) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (3-ethenyl-8-hydroxy-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-5-yl) acetate.
| Compound Name | (3-ethenyl-8-hydroxy-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-5-yl) acetate |
|---|---|
| PubChem CID | 14108801 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (3-ethenyl-8-hydroxy-3,4a,7,7,10a-pentamethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-5-yl) acetate |
| SMILES | C=CC1(C)CCC2C3(C)CCC(O)C(C)(C)C3CC(OC(C)=O)C2(C)O1 |
| InChI | InChI=1S/C22H36O4/c1-8-20(5)11-9-15-21(6)12-10-17(24)19(3,4)16(21)13-18(25-14(2)23)22(15,7)26-20/h8,15-18,24H,1,9-13H2,2-7H3 |
| InChIKey | LZDBSHBOMBJCEC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|