C22H36O3 — CID 102307043
[(3S,4aR,6aS,11aR,11bS)-3-hydroxy-4,4,6a,9,11b-pentamethyl-1,2,3,4a,5,6,7,10,11,11a-decahydrocyclohepta[a]naphthalen-6-yl] acetate (PubChem CID 102307043) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is [(3S,4aR,6aS,11aR,11bS)-3-hydroxy-4,4,6a,9,11b-pentamethyl-1,2,3,4a,5,6,7,10,11,11a-decahydrocyclohepta[a]naphthalen-6-yl] acetate.
| Compound Name | [(3S,4aR,6aS,11aR,11bS)-3-hydroxy-4,4,6a,9,11b-pentamethyl-1,2,3,4a,5,6,7,10,11,11a-decahydrocyclohepta[a]naphthalen-6-yl] acetate |
|---|---|
| PubChem CID | 102307043 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | [(3S,4aR,6aS,11aR,11bS)-3-hydroxy-4,4,6a,9,11b-pentamethyl-1,2,3,4a,5,6,7,10,11,11a-decahydrocyclohepta[a]naphthalen-6-yl] acetate |
| SMILES | CC(=O)OC1C[C@H]2C(C)(C)[C@@H](O)CC[C@]2(C)[C@H]2CCC(C)=CC[C@]12C |
| InChI | InChI=1S/C22H36O3/c1-14-7-8-16-21(5)12-10-18(24)20(3,4)17(21)13-19(25-15(2)23)22(16,6)11-9-14/h9,16-19,24H,7-8,10-13H2,1-6H3/t16-,17+,18+,19?,21-,22+/m1/s1 |
| InChIKey | MLMQUFIOETWOFA-HZRQOBQMSA-N |
| XLogP | 4.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|