C12H20O3 — CID 21116837
[(3R,6S)-6-ethenyl-2,2,6-trimethyloxan-3-yl] acetate (PubChem CID 21116837) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is [(3R,6S)-6-ethenyl-2,2,6-trimethyloxan-3-yl] acetate.
| Compound Name | [(3R,6S)-6-ethenyl-2,2,6-trimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 21116837 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | [(3R,6S)-6-ethenyl-2,2,6-trimethyloxan-3-yl] acetate |
| SMILES | C=C[C@]1(C)CC[C@@H](OC(C)=O)C(C)(C)O1 |
| InChI | InChI=1S/C12H20O3/c1-6-12(5)8-7-10(14-9(2)13)11(3,4)15-12/h6,10H,1,7-8H2,2-5H3/t10-,12-/m1/s1 |
| InChIKey | IRWLDXUJBJPFNV-ZYHUDNBSSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|