C24H34O7 — CID 15618034
[(3R,4aR,5S,10S,10aR,10bS)-5-acetyloxy-3-ethenyl-10b-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-10-yl] acetate (PubChem CID 15618034) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is [(3R,4aR,5S,10S,10aR,10bS)-5-acetyloxy-3-ethenyl-10b-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-10-yl] acetate.
| Compound Name | [(3R,4aR,5S,10S,10aR,10bS)-5-acetyloxy-3-ethenyl-10b-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-10-yl] acetate |
|---|---|
| PubChem CID | 15618034 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(3R,4aR,5S,10S,10aR,10bS)-5-acetyloxy-3-ethenyl-10b-hydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-10-yl] acetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@@]2(O)[C@](C)(O1)[C@@H](OC(C)=O)C=C1C(C)(C)CC[C@H](OC(C)=O)[C@@]12C |
| InChI | InChI=1S/C24H34O7/c1-9-21(6)13-17(27)24(28)22(7)16(12-19(30-15(3)26)23(24,8)31-21)20(4,5)11-10-18(22)29-14(2)25/h9,12,18-19,28H,1,10-11,13H2,2-8H3/t18-,19-,21-,22+,23+,24-/m0/s1 |
| InChIKey | IQKWIHYGVBYQLO-CMDMASODSA-N |
| XLogP | 3.04 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|