C23H36O5 — CID 67326985
[(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1,2,5,8,9,10-hexahydrobenzo[f]chromen-5-yl] propanoate (PubChem CID 67326985) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is [(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1,2,5,8,9,10-hexahydrobenzo[f]chromen-5-yl] propanoate.
| Compound Name | [(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1,2,5,8,9,10-hexahydrobenzo[f]chromen-5-yl] propanoate |
|---|---|
| PubChem CID | 67326985 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | [(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1,2,5,8,9,10-hexahydrobenzo[f]chromen-5-yl] propanoate |
| SMILES | C=C[C@@]1(C)CC[C@@]2(O)[C@](C)(O1)[C@@H](OC(=O)CC)C=C1C(C)(C)CC[C@H](O)[C@@]12C |
| InChI | InChI=1S/C23H36O5/c1-8-18(25)27-17-14-15-19(3,4)11-10-16(24)21(15,6)23(26)13-12-20(5,9-2)28-22(17,23)7/h9,14,16-17,24,26H,2,8,10-13H2,1,3-7H3/t16-,17-,20-,21+,22+,23-/m0/s1 |
| InChIKey | LALDKMCWTBEHBH-PZRBEPACSA-N |
| XLogP | 3.68 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|