C23H34O9 — CID 14424434
[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] 2-formyloxyacetate (PubChem CID 14424434) has the molecular formula C23H34O9 and a molecular weight of 454.52 g/mol. Its IUPAC name is [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] 2-formyloxyacetate.
| Compound Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] 2-formyloxyacetate |
|---|---|
| PubChem CID | 14424434 |
| Molecular Formula | C23H34O9 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] 2-formyloxyacetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3[C@H](O)[C@H](OC(=O)COC=O)[C@@]2(C)O1 |
| InChI | InChI=1S/C23H34O9/c1-7-20(4)10-14(26)23(29)21(5)13(25)8-9-19(2,3)17(21)16(28)18(22(23,6)32-20)31-15(27)11-30-12-24/h7,12-13,16-18,25,28-29H,1,8-11H2,2-6H3/t13-,16-,17-,18-,20-,21-,22+,23-/m0/s1 |
| InChIKey | CUNKEZUKQPQHCM-AXYNBTRTSA-N |
| XLogP | 0.67 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|