C26H41NO9 — CID 10720524
ethyl 3-[[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl]oxycarbonylamino]propanoate (PubChem CID 10720524) has the molecular formula C26H41NO9 and a molecular weight of 511.61 g/mol. Its IUPAC name is ethyl 3-[[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl]oxycarbonylamino]propanoate.
| Compound Name | ethyl 3-[[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl]oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 10720524 |
| Molecular Formula | C26H41NO9 |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | ethyl 3-[[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl]oxycarbonylamino]propanoate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3[C@H](O)[C@H](OC(=O)NCCC(=O)OCC)[C@@]2(C)O1 |
| InChI | InChI=1S/C26H41NO9/c1-8-23(5)14-16(29)26(33)24(6)15(28)10-12-22(3,4)19(24)18(31)20(25(26,7)36-23)35-21(32)27-13-11-17(30)34-9-2/h8,15,18-20,28,31,33H,1,9-14H2,2-7H3,(H,27,32)/t15-,18-,19-,20-,23-,24-,25+,26-/m0/s1 |
| InChIKey | ZIMFERCPRMHCGI-ZHIJWZGUSA-N |
| XLogP | 1.64 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|