C28H45NO7 — CID 10097750
[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] N-(cyclohexylmethyl)carbamate (PubChem CID 10097750) has the molecular formula C28H45NO7 and a molecular weight of 507.67 g/mol. Its IUPAC name is [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] N-(cyclohexylmethyl)carbamate.
| Compound Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] N-(cyclohexylmethyl)carbamate |
|---|---|
| PubChem CID | 10097750 |
| Molecular Formula | C28H45NO7 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] N-(cyclohexylmethyl)carbamate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3[C@H](O)[C@H](OC(=O)NCC3CCCCC3)[C@@]2(C)O1 |
| InChI | InChI=1S/C28H45NO7/c1-7-25(4)15-19(31)28(34)26(5)18(30)13-14-24(2,3)21(26)20(32)22(27(28,6)36-25)35-23(33)29-16-17-11-9-8-10-12-17/h7,17-18,20-22,30,32,34H,1,8-16H2,2-6H3,(H,29,33)/t18-,20-,21-,22-,25-,26-,27+,28-/m0/s1 |
| InChIKey | DJOLPWJHZINFGR-FCTGTBMNSA-N |
| XLogP | 3.26 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|