C23H37NO7 — CID 14800851
[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] N-ethylcarbamate (PubChem CID 14800851) has the molecular formula C23H37NO7 and a molecular weight of 439.55 g/mol. Its IUPAC name is [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] N-ethylcarbamate.
| Compound Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 14800851 |
| Molecular Formula | C23H37NO7 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] N-ethylcarbamate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3[C@H](O)[C@H](OC(=O)NCC)[C@@]2(C)O1 |
| InChI | InChI=1S/C23H37NO7/c1-8-20(5)12-14(26)23(29)21(6)13(25)10-11-19(3,4)16(21)15(27)17(22(23,7)31-20)30-18(28)24-9-2/h8,13,15-17,25,27,29H,1,9-12H2,2-7H3,(H,24,28)/t13-,15-,16-,17-,20-,21-,22+,23-/m0/s1 |
| InChIKey | JGOHJLVBPQALQG-LKMRROBQSA-N |
| XLogP | 1.70 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|