C25H37NO9 — CID 173389951
[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] N-(3-oxobut-1-enoxy)carbamate (PubChem CID 173389951) has the molecular formula C25H37NO9 and a molecular weight of 495.57 g/mol. Its IUPAC name is [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] N-(3-oxobut-1-enoxy)carbamate.
| Compound Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] N-(3-oxobut-1-enoxy)carbamate |
|---|---|
| PubChem CID | 173389951 |
| Molecular Formula | C25H37NO9 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] N-(3-oxobut-1-enoxy)carbamate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3[C@H](O)[C@H](OC(=O)NOC=CC(C)=O)[C@@]2(C)O1 |
| InChI | InChI=1S/C25H37NO9/c1-8-22(5)13-16(29)25(32)23(6)15(28)9-11-21(3,4)18(23)17(30)19(24(25,7)35-22)34-20(31)26-33-12-10-14(2)27/h8,10,12,15,17-19,28,30,32H,1,9,11,13H2,2-7H3,(H,26,31)/t15-,17-,18-,19-,22-,23-,24+,25-/m0/s1 |
| InChIKey | GASNFHNQOOIRFC-OCJTYSPUSA-N |
| XLogP | 1.72 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|