C25H37NO8 — CID 18641535
[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] (2S)-5-oxopyrrolidine-2-carboxylate (PubChem CID 18641535) has the molecular formula C25H37NO8 and a molecular weight of 479.57 g/mol. Its IUPAC name is [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] (2S)-5-oxopyrrolidine-2-carboxylate.
| Compound Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] (2S)-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 18641535 |
| Molecular Formula | C25H37NO8 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] (2S)-5-oxopyrrolidine-2-carboxylate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3[C@H](O)[C@H](OC(=O)[C@@H]3CCC(=O)N3)[C@@]2(C)O1 |
| InChI | InChI=1S/C25H37NO8/c1-7-22(4)12-15(28)25(32)23(5)14(27)10-11-21(2,3)18(23)17(30)19(24(25,6)34-22)33-20(31)13-8-9-16(29)26-13/h7,13-14,17-19,27,30,32H,1,8-12H2,2-6H3,(H,26,29)/t13-,14-,17-,18-,19-,22-,23-,24+,25-/m0/s1 |
| InChIKey | NOXGAJBFSRJVNN-JMLFIWAPSA-N |
| XLogP | 0.78 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|