C28H43NO10 — CID 15618010
[2-[[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl]oxy]-2-oxoethyl] 2-morpholin-4-ylacetate (PubChem CID 15618010) has the molecular formula C28H43NO10 and a molecular weight of 553.65 g/mol. Its IUPAC name is [2-[[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl]oxy]-2-oxoethyl] 2-morpholin-4-ylacetate.
| Compound Name | [2-[[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl]oxy]-2-oxoethyl] 2-morpholin-4-ylacetate |
|---|---|
| PubChem CID | 15618010 |
| Molecular Formula | C28H43NO10 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | [2-[[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl]oxy]-2-oxoethyl] 2-morpholin-4-ylacetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3[C@H](O)[C@H](OC(=O)COC(=O)CN3CCOCC3)[C@@]2(C)O1 |
| InChI | InChI=1S/C28H43NO10/c1-7-25(4)14-18(31)28(35)26(5)17(30)8-9-24(2,3)22(26)21(34)23(27(28,6)39-25)38-20(33)16-37-19(32)15-29-10-12-36-13-11-29/h7,17,21-23,30,34-35H,1,8-16H2,2-6H3/t17-,21-,22-,23-,25-,26-,27+,28-/m0/s1 |
| InChIKey | FPOYTIQVJONSCZ-OJNQCDOFSA-N |
| XLogP | 0.38 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|