C24H36O8 — CID 11190222
[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-6-acetyloxy-3-ethenyl-5,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-10-yl] acetate (PubChem CID 11190222) has the molecular formula C24H36O8 and a molecular weight of 452.54 g/mol. Its IUPAC name is [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-6-acetyloxy-3-ethenyl-5,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-10-yl] acetate.
| Compound Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-6-acetyloxy-3-ethenyl-5,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-10-yl] acetate |
|---|---|
| PubChem CID | 11190222 |
| Molecular Formula | C24H36O8 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-6-acetyloxy-3-ethenyl-5,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-10-yl] acetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](OC(C)=O)CCC(C)(C)[C@@H]3[C@H](OC(C)=O)[C@H](O)[C@@]2(C)O1 |
| InChI | InChI=1S/C24H36O8/c1-9-21(6)12-15(27)24(29)22(7)16(30-13(2)25)10-11-20(4,5)18(22)17(31-14(3)26)19(28)23(24,8)32-21/h9,16-19,28-29H,1,10-12H2,2-8H3/t16-,17-,18-,19-,21-,22-,23+,24-/m0/s1 |
| InChIKey | JSLBYYLMKKSQQW-AQLRWBRBSA-N |
| XLogP | 2.09 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|