C27H43NO9 — CID 57021717
[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 57021717) has the molecular formula C27H43NO9 and a molecular weight of 525.64 g/mol. Its IUPAC name is [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 57021717 |
| Molecular Formula | C27H43NO9 |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3[C@H](OC(=O)CNC(=O)OC(C)(C)C)[C@H](O)[C@@]2(C)O1 |
| InChI | InChI=1S/C27H43NO9/c1-10-24(7)13-16(30)27(34)25(8)15(29)11-12-23(5,6)19(25)18(20(32)26(27,9)37-24)35-17(31)14-28-21(33)36-22(2,3)4/h10,15,18-20,29,32,34H,1,11-14H2,2-9H3,(H,28,33)/t15-,18-,19-,20-,24-,25-,26+,27-/m0/s1 |
| InChIKey | DDRFQUADKMFVGU-DXADZBHCSA-N |
| XLogP | 2.02 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|