C26H41NO8 — CID 163477845
[(3R,4aR,6S,10aR)-5-acetyloxy-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 4-aminobutanoate (PubChem CID 163477845) has the molecular formula C26H41NO8 and a molecular weight of 495.61 g/mol. Its IUPAC name is [(3R,4aR,6S,10aR)-5-acetyloxy-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 4-aminobutanoate.
| Compound Name | [(3R,4aR,6S,10aR)-5-acetyloxy-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 4-aminobutanoate |
|---|---|
| PubChem CID | 163477845 |
| Molecular Formula | C26H41NO8 |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | [(3R,4aR,6S,10aR)-5-acetyloxy-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 4-aminobutanoate |
| SMILES | C=C[C@@]1(C)CC(=O)C2(O)[C@@]3(C)C(O)CCC(C)(C)C3[C@H](OC(=O)CCCN)C(OC(C)=O)[C@@]2(C)O1 |
| InChI | InChI=1S/C26H41NO8/c1-8-23(5)14-17(30)26(32)24(6)16(29)11-12-22(3,4)20(24)19(34-18(31)10-9-13-27)21(33-15(2)28)25(26,7)35-23/h8,16,19-21,29,32H,1,9-14,27H2,2-7H3/t16?,19-,20?,21?,23-,24-,25+,26?/m0/s1 |
| InChIKey | CBZADFNYMLCEHF-MNFOZPPBSA-N |
| XLogP | 1.81 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|