C18H30O4 — CID 23642987
[(1'S,4'aS,8'aS)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,4a,6,7,8-hexahydro-1H-naphthalene]-1'-yl]methyl acetate (PubChem CID 23642987) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is [(1'S,4'aS,8'aS)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,4a,6,7,8-hexahydro-1H-naphthalene]-1'-yl]methyl acetate.
| Compound Name | [(1'S,4'aS,8'aS)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,4a,6,7,8-hexahydro-1H-naphthalene]-1'-yl]methyl acetate |
|---|---|
| PubChem CID | 23642987 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | [(1'S,4'aS,8'aS)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,4a,6,7,8-hexahydro-1H-naphthalene]-1'-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C2(CC[C@H]3C(C)(C)CCC[C@@]31C)OCCO2 |
| InChI | InChI=1S/C18H30O4/c1-13(19)20-12-15-17(4)8-5-7-16(2,3)14(17)6-9-18(15)21-10-11-22-18/h14-15H,5-12H2,1-4H3/t14-,15+,17-/m0/s1 |
| InChIKey | KFSIPVZMOWIMBF-UXLLHSPISA-N |
| XLogP | 3.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |