C20H28O5S — CID 11003407
[(3E)-3-[2-(benzenesulfonyl)ethylidene]-6-hydroxy-2,2,6-trimethylcyclohexyl]methyl acetate (PubChem CID 11003407) has the molecular formula C20H28O5S and a molecular weight of 380.51 g/mol. Its IUPAC name is [(3E)-3-[2-(benzenesulfonyl)ethylidene]-6-hydroxy-2,2,6-trimethylcyclohexyl]methyl acetate.
| Compound Name | [(3E)-3-[2-(benzenesulfonyl)ethylidene]-6-hydroxy-2,2,6-trimethylcyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 11003407 |
| Molecular Formula | C20H28O5S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [(3E)-3-[2-(benzenesulfonyl)ethylidene]-6-hydroxy-2,2,6-trimethylcyclohexyl]methyl acetate |
| SMILES | CC(=O)OCC1C(C)(O)CC/C(=C\CS(=O)(=O)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C20H28O5S/c1-15(21)25-14-18-19(2,3)16(10-12-20(18,4)22)11-13-26(23,24)17-8-6-5-7-9-17/h5-9,11,18,22H,10,12-14H2,1-4H3/b16-11+ |
| InChIKey | OTTRSSHIPMHJJU-LFIBNONCSA-N |
| XLogP | 3.14 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|