C11H12O4S — CID 10399384
(E)-4-(benzenesulfonyl)-2-methylbut-2-enoic acid (PubChem CID 10399384) has the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. Its IUPAC name is (E)-4-(benzenesulfonyl)-2-methylbut-2-enoic acid.
| Compound Name | (E)-4-(benzenesulfonyl)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 10399384 |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | (E)-4-(benzenesulfonyl)-2-methylbut-2-enoic acid |
| SMILES | C/C(=C\CS(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H12O4S/c1-9(11(12)13)7-8-16(14,15)10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,12,13)/b9-7+ |
| InChIKey | PQVQBQDIKDITTH-VQHVLOKHSA-N |
| XLogP | 1.49 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|