C18H31NO4 — CID 135034783
2-[(1R,2S,4aS,8aR)-2-hydroxy-8a-[(E)-hydroxyiminomethyl]-2,5,5-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl acetate (PubChem CID 135034783) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-[(1R,2S,4aS,8aR)-2-hydroxy-8a-[(E)-hydroxyiminomethyl]-2,5,5-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl acetate.
| Compound Name | 2-[(1R,2S,4aS,8aR)-2-hydroxy-8a-[(E)-hydroxyiminomethyl]-2,5,5-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 135034783 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 2-[(1R,2S,4aS,8aR)-2-hydroxy-8a-[(E)-hydroxyiminomethyl]-2,5,5-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@@H]1[C@@]2(/C=N/O)CCCC(C)(C)[C@@H]2CC[C@]1(C)O |
| InChI | InChI=1S/C18H31NO4/c1-13(20)23-11-7-15-17(4,21)10-6-14-16(2,3)8-5-9-18(14,15)12-19-22/h12,14-15,21-22H,5-11H2,1-4H3/b19-12+/t14-,15-,17-,18+/m0/s1 |
| InChIKey | XKQAGJRZZOOGIW-YLXYVHJXSA-N |
| XLogP | 3.37 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|