C23H30O5 — CID 534511
(4,4,13-trimethyl-3,7,17-trioxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-10-yl)methyl acetate (PubChem CID 534511) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (4,4,13-trimethyl-3,7,17-trioxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-10-yl)methyl acetate.
| Compound Name | (4,4,13-trimethyl-3,7,17-trioxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-10-yl)methyl acetate |
|---|---|
| PubChem CID | 534511 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (4,4,13-trimethyl-3,7,17-trioxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-10-yl)methyl acetate |
| SMILES | CC(=O)OCC12CCC(=O)C(C)(C)C1=CC(=O)C1C3CCC(=O)C3(C)CCC12 |
| InChI | InChI=1S/C23H30O5/c1-13(24)28-12-23-10-8-18(26)21(2,3)17(23)11-16(25)20-14-5-6-19(27)22(14,4)9-7-15(20)23/h11,14-15,20H,5-10,12H2,1-4H3 |
| InChIKey | ADYJFSJZIVWTQO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |