C21H26O4 — CID 141339357
[(8R,9S,10R,13S,14S)-10-methyl-7,17-dioxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-13-yl]methyl acetate (PubChem CID 141339357) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S)-10-methyl-7,17-dioxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-13-yl]methyl acetate.
| Compound Name | [(8R,9S,10R,13S,14S)-10-methyl-7,17-dioxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-13-yl]methyl acetate |
|---|---|
| PubChem CID | 141339357 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [(8R,9S,10R,13S,14S)-10-methyl-7,17-dioxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-13-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CC[C@H]3[C@@H](C(=O)C=C4C=CCC[C@@]43C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C21H26O4/c1-13(22)25-12-21-10-8-15-19(16(21)6-7-18(21)24)17(23)11-14-5-3-4-9-20(14,15)2/h3,5,11,15-16,19H,4,6-10,12H2,1-2H3/t15-,16-,19+,20-,21+/m0/s1 |
| InChIKey | FGVAWQARWLKYNB-ZNRKGROKSA-N |
| XLogP | 3.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |