C12H23N3O4 — CID 155683048
1,2,2,6,6-pentamethyl-4,4-bis(nitromethyl)piperidine (PubChem CID 155683048) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-4,4-bis(nitromethyl)piperidine.
| Compound Name | 1,2,2,6,6-pentamethyl-4,4-bis(nitromethyl)piperidine |
|---|---|
| PubChem CID | 155683048 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-4,4-bis(nitromethyl)piperidine |
| SMILES | CN1C(C)(C)CC(C[N+](=O)[O-])(C[N+](=O)[O-])CC1(C)C |
| InChI | InChI=1S/C12H23N3O4/c1-10(2)6-12(8-14(16)17,9-15(18)19)7-11(3,4)13(10)5/h6-9H2,1-5H3 |
| InChIKey | HJTXCKSYBDVHCH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|