C8H15ClN2O2 — CID 14749486
8-(nitromethyl)-1,2,3,5,6,7-hexahydropyrrolizine;hydrochloride (PubChem CID 14749486) has the molecular formula C8H15ClN2O2 and a molecular weight of 206.67 g/mol. Its IUPAC name is 8-(nitromethyl)-1,2,3,5,6,7-hexahydropyrrolizine;hydrochloride.
| Compound Name | 8-(nitromethyl)-1,2,3,5,6,7-hexahydropyrrolizine;hydrochloride |
|---|---|
| PubChem CID | 14749486 |
| Molecular Formula | C8H15ClN2O2 |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 8-(nitromethyl)-1,2,3,5,6,7-hexahydropyrrolizine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])CC12CCCN1CCC2 |
| InChI | InChI=1S/C8H14N2O2.ClH/c11-10(12)7-8-3-1-5-9(8)6-2-4-8;/h1-7H2;1H |
| InChIKey | DBETWQYZULHLPL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|