C15H24N4O8 — CID 101397812
3,3-dinitro-2-[1-(nitromethyl)cyclohexyl]oxy-1-oxa-2-azaspiro[4.5]decane (PubChem CID 101397812) has the molecular formula C15H24N4O8 and a molecular weight of 388.38 g/mol. Its IUPAC name is 3,3-dinitro-2-[1-(nitromethyl)cyclohexyl]oxy-1-oxa-2-azaspiro[4.5]decane.
| Compound Name | 3,3-dinitro-2-[1-(nitromethyl)cyclohexyl]oxy-1-oxa-2-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 101397812 |
| Molecular Formula | C15H24N4O8 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3,3-dinitro-2-[1-(nitromethyl)cyclohexyl]oxy-1-oxa-2-azaspiro[4.5]decane |
| SMILES | O=[N+]([O-])CC1(ON2OC3(CCCCC3)CC2([N+](=O)[O-])[N+](=O)[O-])CCCCC1 |
| InChI | InChI=1S/C15H24N4O8/c20-16(21)12-14(9-5-2-6-10-14)27-19-15(17(22)23,18(24)25)11-13(26-19)7-3-1-4-8-13/h1-12H2 |
| InChIKey | WIAQJISRMAVBGP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 151.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|