About 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane
3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane (PubChem CID 604101) has the molecular formula C11H19NO4
and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 604101 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane |
| SMILES | CC(C[N+](=O)[O-])C1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C11H19NO4/c1-9(7-12(13)14)10-8-15-11(16-10)5-3-2-4-6-11/h9-10H,2-8H2,1H3 |
| InChIKey | HBKNMUPPRPDBPZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane (CID 604101) is 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane is CC(C[N+](=O)[O-])C1COC2(CCCCC2)O1.
What is the InChIKey of 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane?
The InChIKey is HBKNMUPPRPDBPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO4/c1-9(7-12(13)14)10-8-15-11(16-10)5-3-2-4-6-11/h9-10H,2-8H2,1H3.
What are the key properties of 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane?
3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane has a molecular weight of 229.28 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-nitropropan-2-yl)-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 604101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).