C13H18N4O9 — CID 4105592
1-[3,3-dinitro-2-[1-(1-nitrocyclobutyl)cyclobutyl]oxy-1,2-oxazolidin-5-yl]ethanone (PubChem CID 4105592) has the molecular formula C13H18N4O9 and a molecular weight of 374.31 g/mol. Its IUPAC name is 1-[3,3-dinitro-2-[1-(1-nitrocyclobutyl)cyclobutyl]oxy-1,2-oxazolidin-5-yl]ethanone.
| Compound Name | 1-[3,3-dinitro-2-[1-(1-nitrocyclobutyl)cyclobutyl]oxy-1,2-oxazolidin-5-yl]ethanone |
|---|---|
| PubChem CID | 4105592 |
| Molecular Formula | C13H18N4O9 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-[3,3-dinitro-2-[1-(1-nitrocyclobutyl)cyclobutyl]oxy-1,2-oxazolidin-5-yl]ethanone |
| SMILES | CC(=O)C1CC([N+](=O)[O-])([N+](=O)[O-])N(OC2(C3([N+](=O)[O-])CCC3)CCC2)O1 |
| InChI | InChI=1S/C13H18N4O9/c1-9(18)10-8-13(15(21)22,16(23)24)17(25-10)26-12(6-3-7-12)11(14(19)20)4-2-5-11/h10H,2-8H2,1H3 |
| InChIKey | AXQVRAWPKNWDKQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 168.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|