C12H20NO3- — CID 22983027
1-(3-methyl-2-oxido-4,5,5a,6,7,8,9,9a-octahydrobenzo[f]oxazepin-3-yl)ethanone (PubChem CID 22983027) has the molecular formula C12H20NO3- and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-(3-methyl-2-oxido-4,5,5a,6,7,8,9,9a-octahydrobenzo[f]oxazepin-3-yl)ethanone.
| Compound Name | 1-(3-methyl-2-oxido-4,5,5a,6,7,8,9,9a-octahydrobenzo[f]oxazepin-3-yl)ethanone |
|---|---|
| PubChem CID | 22983027 |
| Molecular Formula | C12H20NO3- |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 1-(3-methyl-2-oxido-4,5,5a,6,7,8,9,9a-octahydrobenzo[f]oxazepin-3-yl)ethanone |
| SMILES | CC(=O)C1(C)CCC2CCCCC2ON1[O-] |
| InChI | InChI=1S/C12H20NO3/c1-9(14)12(2)8-7-10-5-3-4-6-11(10)16-13(12)15/h10-11H,3-8H2,1-2H3/q-1 |
| InChIKey | DIEZKUCSWIZAKY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |