acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene

C13H24O2 — CID 174905675

IUPACacetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene
SMILESCC(=O)O.CC1(C)CCC2CCCCC21
InChIInChI=1S/C11H20.C2H4O2/c1-11(2)8-7-9-5-3-4-6-10(9)11;1-2(3)4/h9-10H,3-8H2,1-2H3;1H3,(H,3,4)
InChIKeyXOVLJLUZENJVLU-UHFFFAOYSA-N
MW212.33 g/mol
LogP3.70
Rot. Bonds

About acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene

acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene (PubChem CID 174905675) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene.

Molecular Properties

Compound Nameacetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene
PubChem CID174905675
Molecular FormulaC13H24O2
Molecular Weight212.33 g/mol
Exact Mass212.18
IUPAC Nameacetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene
SMILESCC(=O)O.CC1(C)CCC2CCCCC21
InChIInChI=1S/C11H20.C2H4O2/c1-11(2)8-7-9-5-3-4-6-10(9)11;1-2(3)4/h9-10H,3-8H2,1-2H3;1H3,(H,3,4)
InChIKeyXOVLJLUZENJVLU-UHFFFAOYSA-N
XLogP3.70
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.33
LogP ≤ 53.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene?
The IUPAC name of acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene (CID 174905675) is acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene.
What is the SMILES notation for acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene?
The canonical SMILES for acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene is CC(=O)O.CC1(C)CCC2CCCCC21.
What is the InChIKey of acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene?
The InChIKey is XOVLJLUZENJVLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20.C2H4O2/c1-11(2)8-7-9-5-3-4-6-10(9)11;1-2(3)4/h9-10H,3-8H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene?
acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene has a molecular weight of 212.33 g/mol, XLogP of 3.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroindene is sourced from PubChem (CID 174905675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).