C22H36O2 — CID 122533391
(1,2-dicyclohexylcyclohexyl) 2-methylprop-2-enoate (PubChem CID 122533391) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (1,2-dicyclohexylcyclohexyl) 2-methylprop-2-enoate.
| Compound Name | (1,2-dicyclohexylcyclohexyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122533391 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (1,2-dicyclohexylcyclohexyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C2CCCCC2)CCCCC1C1CCCCC1 |
| InChI | InChI=1S/C22H36O2/c1-17(2)21(23)24-22(19-13-7-4-8-14-19)16-10-9-15-20(22)18-11-5-3-6-12-18/h18-20H,1,3-16H2,2H3 |
| InChIKey | TZVBCLOJIZRQHJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|