C20H30O2 — CID 58887066
(2-cyclohexyl-2-adamantyl) 2-methylprop-2-enoate (PubChem CID 58887066) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (2-cyclohexyl-2-adamantyl) 2-methylprop-2-enoate.
| Compound Name | (2-cyclohexyl-2-adamantyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58887066 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (2-cyclohexyl-2-adamantyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C2CCCCC2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H30O2/c1-13(2)19(21)22-20(16-6-4-3-5-7-16)17-9-14-8-15(11-17)12-18(20)10-14/h14-18H,1,3-12H2,2H3 |
| InChIKey | KQKDQZNFPSZETP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|