C19H28O4 — CID 141485230
(1-cyclohexyl-2-prop-2-enoyloxycyclohexyl) 2-methylprop-2-enoate (PubChem CID 141485230) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (1-cyclohexyl-2-prop-2-enoyloxycyclohexyl) 2-methylprop-2-enoate.
| Compound Name | (1-cyclohexyl-2-prop-2-enoyloxycyclohexyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141485230 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (1-cyclohexyl-2-prop-2-enoyloxycyclohexyl) 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OC1CCCCC1(OC(=O)C(=C)C)C1CCCCC1 |
| InChI | InChI=1S/C19H28O4/c1-4-17(20)22-16-12-8-9-13-19(16,23-18(21)14(2)3)15-10-6-5-7-11-15/h4,15-16H,1-2,5-13H2,3H3 |
| InChIKey | UJVJOIXKDSZYCF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|