C23H38O4 — CID 175512236
(2-ethyl-2-methylcyclopentyl) 2-methylprop-2-enoate;(2-ethyl-2-methylcyclopentyl) prop-2-enoate (PubChem CID 175512236) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is (2-ethyl-2-methylcyclopentyl) 2-methylprop-2-enoate;(2-ethyl-2-methylcyclopentyl) prop-2-enoate.
| Compound Name | (2-ethyl-2-methylcyclopentyl) 2-methylprop-2-enoate;(2-ethyl-2-methylcyclopentyl) prop-2-enoate |
|---|---|
| PubChem CID | 175512236 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | (2-ethyl-2-methylcyclopentyl) 2-methylprop-2-enoate;(2-ethyl-2-methylcyclopentyl) prop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCC1(C)CC.C=CC(=O)OC1CCCC1(C)CC |
| InChI | InChI=1S/C12H20O2.C11H18O2/c1-5-12(4)8-6-7-10(12)14-11(13)9(2)3;1-4-10(12)13-9-7-6-8-11(9,3)5-2/h10H,2,5-8H2,1,3-4H3;4,9H,1,5-8H2,2-3H3 |
| InChIKey | CVAGZEHQAFMCHR-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|