C15H22O6 — CID 152730237
2-ethyl-1-methyl-3-(2-methylprop-2-enoyloxy)cyclohexane-1,2-dicarboxylic acid (PubChem CID 152730237) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-ethyl-1-methyl-3-(2-methylprop-2-enoyloxy)cyclohexane-1,2-dicarboxylic acid.
| Compound Name | 2-ethyl-1-methyl-3-(2-methylprop-2-enoyloxy)cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 152730237 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-ethyl-1-methyl-3-(2-methylprop-2-enoyloxy)cyclohexane-1,2-dicarboxylic acid |
| SMILES | C=C(C)C(=O)OC1CCCC(C)(C(=O)O)C1(CC)C(=O)O |
| InChI | InChI=1S/C15H22O6/c1-5-15(13(19)20)10(21-11(16)9(2)3)7-6-8-14(15,4)12(17)18/h10H,2,5-8H2,1,3-4H3,(H,17,18)(H,19,20) |
| InChIKey | ZXLOAIWBDKDDPM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|