C15H22O3 — CID 91156193
(8a-hydroxy-2,3,3a,4,5,5a,6,7,8,8b-decahydro-1H-acenaphthylen-1-yl) prop-2-enoate (PubChem CID 91156193) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (8a-hydroxy-2,3,3a,4,5,5a,6,7,8,8b-decahydro-1H-acenaphthylen-1-yl) prop-2-enoate.
| Compound Name | (8a-hydroxy-2,3,3a,4,5,5a,6,7,8,8b-decahydro-1H-acenaphthylen-1-yl) prop-2-enoate |
|---|---|
| PubChem CID | 91156193 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (8a-hydroxy-2,3,3a,4,5,5a,6,7,8,8b-decahydro-1H-acenaphthylen-1-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1CC2CCCC3CCCC1(O)C32 |
| InChI | InChI=1S/C15H22O3/c1-2-13(16)18-12-9-11-6-3-5-10-7-4-8-15(12,17)14(10)11/h2,10-12,14,17H,1,3-9H2 |
| InChIKey | FIMSECVKQYFQSW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|