C17H26O3 — CID 20648003
[(4aR,8aS,9aS,10aR)-9a-hydroxy-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydroanthracen-4a-yl] prop-2-enoate (PubChem CID 20648003) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is [(4aR,8aS,9aS,10aR)-9a-hydroxy-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydroanthracen-4a-yl] prop-2-enoate.
| Compound Name | [(4aR,8aS,9aS,10aR)-9a-hydroxy-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydroanthracen-4a-yl] prop-2-enoate |
|---|---|
| PubChem CID | 20648003 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [(4aR,8aS,9aS,10aR)-9a-hydroxy-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydroanthracen-4a-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@]12CCCC[C@]1(O)C[C@@H]1CCCC[C@@H]1C2 |
| InChI | InChI=1S/C17H26O3/c1-2-15(18)20-17-10-6-5-9-16(17,19)11-13-7-3-4-8-14(13)12-17/h2,13-14,19H,1,3-12H2/t13-,14+,16-,17+/m0/s1 |
| InChIKey | HXDBBDZREAUEEE-HDEZJCGLSA-N |
| XLogP | 3.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|