C20H32O2 — CID 70032504
2-[(4aR,8aS,9aS,10aR)-2,3,4,5,6,7,8,8a,9,9a,10,10a-dodecahydro-1H-anthracen-4a-yl]propan-2-yl prop-2-enoate (PubChem CID 70032504) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 2-[(4aR,8aS,9aS,10aR)-2,3,4,5,6,7,8,8a,9,9a,10,10a-dodecahydro-1H-anthracen-4a-yl]propan-2-yl prop-2-enoate.
| Compound Name | 2-[(4aR,8aS,9aS,10aR)-2,3,4,5,6,7,8,8a,9,9a,10,10a-dodecahydro-1H-anthracen-4a-yl]propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 70032504 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 2-[(4aR,8aS,9aS,10aR)-2,3,4,5,6,7,8,8a,9,9a,10,10a-dodecahydro-1H-anthracen-4a-yl]propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)[C@@]12CCCC[C@H]1C[C@@H]1CCCC[C@@H]1C2 |
| InChI | InChI=1S/C20H32O2/c1-4-18(21)22-19(2,3)20-12-8-7-11-17(20)13-15-9-5-6-10-16(15)14-20/h4,15-17H,1,5-14H2,2-3H3/t15-,16+,17-,20+/m0/s1 |
| InChIKey | SAVNZVOBJGRWMC-PFRQMTDMSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|