C17H27NO3 — CID 11818680
[(4R,5S,9S)-9-(2,2-dimethylpropanoylamino)spiro[4.4]nonan-4-yl] prop-2-enoate (PubChem CID 11818680) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is [(4R,5S,9S)-9-(2,2-dimethylpropanoylamino)spiro[4.4]nonan-4-yl] prop-2-enoate.
| Compound Name | [(4R,5S,9S)-9-(2,2-dimethylpropanoylamino)spiro[4.4]nonan-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 11818680 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | [(4R,5S,9S)-9-(2,2-dimethylpropanoylamino)spiro[4.4]nonan-4-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H]1CCC[C@]12CCC[C@@H]2NC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H27NO3/c1-5-14(19)21-13-9-7-11-17(13)10-6-8-12(17)18-15(20)16(2,3)4/h5,12-13H,1,6-11H2,2-4H3,(H,18,20)/t12-,13+,17-/m0/s1 |
| InChIKey | GXGKQZFIESPREN-AHIWAGSCSA-N |
| XLogP | 2.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|