C23H35NO3 — CID 11268804
[(4R,5S,9S)-9-(2,2-dimethylpropanoylamino)spiro[4.4]nonan-4-yl] (1R,2R,4R)-bicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 11268804) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is [(4R,5S,9S)-9-(2,2-dimethylpropanoylamino)spiro[4.4]nonan-4-yl] (1R,2R,4R)-bicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | [(4R,5S,9S)-9-(2,2-dimethylpropanoylamino)spiro[4.4]nonan-4-yl] (1R,2R,4R)-bicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11268804 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | [(4R,5S,9S)-9-(2,2-dimethylpropanoylamino)spiro[4.4]nonan-4-yl] (1R,2R,4R)-bicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | CC(C)(C)C(=O)N[C@H]1CCC[C@]12CCC[C@H]2OC(=O)[C@@H]1C[C@@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C23H35NO3/c1-22(2,3)21(26)24-18-6-4-12-23(18)13-5-7-19(23)27-20(25)17-14-15-8-10-16(17)11-9-15/h8,10,15-19H,4-7,9,11-14H2,1-3H3,(H,24,26)/t15-,16+,17-,18+,19-,23+/m1/s1 |
| InChIKey | MADFWMDEKYQGKZ-LVIHOWEASA-N |
| XLogP | 4.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|